CAS 1649455-09-3 is the registry number for 4-Chloro-6-(4-methoxyphenyl)-7-(phenylsulfonyl)-7H-pyrrolo[2,3-d]pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-(benzenesulfonyl)-4-chloro-6-(4-methoxyphenyl)pyrrolo[2,3-d]pyrimidine (CAS 1649455-09-3) is a chemical compound with the molecular formula C19H14ClN3O3S and a molecular weight of 399.9 g/mol. IUPAC name: 7-(benzenesulfonyl)-4-chloro-6-(4-methoxyphenyl)pyrrolo[2,3-d]pyrimidine. InChIKey: ZIIHVYILOTXAQQ-UHFFFAOYSA-N.
| Molecular formula | C19H14ClN3O3S |
|---|---|
| Molecular weight | 399.9 g/mol |
| IUPAC name | 7-(benzenesulfonyl)-4-chloro-6-(4-methoxyphenyl)pyrrolo[2,3-d]pyrimidine |
| InChIKey | ZIIHVYILOTXAQQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC3=C(N2S(=O)(=O)C4=CC=CC=C4)N=CN=C3Cl |
Computed by PubChem (NCBI)