Products 1649473-36-8
CAS 1649473-36-8 is the registry number for Antibacterial agent 198. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[3-[4-[4-(trifluoromethyl)phenoxy]phenyl]-1,2,4-oxadiazol-5-yl]aniline;hydrochloride (CAS 1649473-36-8) is a chemical compound with the molecular formula C21H15ClF3N3O2 and a molecular weight of 433.8 g/mol. IUPAC name: 4-[3-[4-[4-(trifluoromethyl)phenoxy]phenyl]-1,2,4-oxadiazol-5-yl]aniline;hydrochloride. InChIKey: BQPQCOCMAMWUDI-UHFFFAOYSA-N.
| Molecular formula | C21H15ClF3N3O2 |
|---|---|
| Molecular weight | 433.8 g/mol |
| IUPAC name | 4-[3-[4-[4-(trifluoromethyl)phenoxy]phenyl]-1,2,4-oxadiazol-5-yl]aniline;hydrochloride |
| InChIKey | BQPQCOCMAMWUDI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=NO2)C3=CC=C(C=C3)OC4=CC=C(C=C4)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
Antibacterial agent 198, orb2567013