CAS 164982-01-8 appears in our catalog under these names: 1-(4-Chloro-2-fluorophenyl)-3,5-dimethyl-1h-pyrazole, 95%, 1-(4-Chloro-2-fluorophenyl)-3,5-dimethyl-1H-pyrazole, 98%, 1-(4-Chloro-2-fluorophenyl)-3,5-dimethyl-1H-pyrazole. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
1-(4-chloro-2-fluorophenyl)-3,5-dimethylpyrazole (CAS 164982-01-8) is a chemical compound with the molecular formula C11H10ClFN2 and a molecular weight of 224.66 g/mol. IUPAC name: 1-(4-chloro-2-fluorophenyl)-3,5-dimethylpyrazole. InChIKey: WALQKLLVTNFKKR-UHFFFAOYSA-N.
| Molecular formula | C11H10ClFN2 |
|---|---|
| Molecular weight | 224.66 g/mol |
| IUPAC name | 1-(4-chloro-2-fluorophenyl)-3,5-dimethylpyrazole |
| InChIKey | WALQKLLVTNFKKR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=C(C=C(C=C2)Cl)F)C |
Computed by PubChem (NCBI)