CAS 1650636-04-6 is the registry number for 4-(3-Aminobutyl)-phen-2,3,5,6-d4-ol. Offered by: TRC. Available pack sizes: 100mg.
4-(3-aminobutyl)-2,3,5,6-tetradeuteriophenol (CAS 1650636-04-6) is a chemical compound with the molecular formula C10H15NO and a molecular weight of 169.26 g/mol. IUPAC name: 4-(3-aminobutyl)-2,3,5,6-tetradeuteriophenol. InChIKey: WNTVTQIJPAFZEL-UGWFXTGHSA-N.
| Molecular formula | C10H15NO |
|---|---|
| Molecular weight | 169.26 g/mol |
| IUPAC name | 4-(3-aminobutyl)-2,3,5,6-tetradeuteriophenol |
| InChIKey | WNTVTQIJPAFZEL-UGWFXTGHSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1CCC(C)N)[2H])[2H])O)[2H] |
Computed by PubChem (NCBI)