Products 165074-00-0
CAS 165074-00-0 is the registry number for 6-Epidemethylesquirolin D. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, Get quote.
11,11-dimethyl-5-propan-2-yl-16-oxatetracyclo[6.6.2.01,10.02,7]hexadeca-2,4,6-triene-3,4,9,15-tetrol (CAS 165074-00-0) is a chemical compound with the molecular formula C20H28O5 and a molecular weight of 348.4 g/mol. IUPAC name: 11,11-dimethyl-5-propan-2-yl-16-oxatetracyclo[6.6.2.01,10.02,7]hexadeca-2,4,6-triene-3,4,9,15-tetrol. InChIKey: BIRAIVMEZFVLJK-UHFFFAOYSA-N.
| Molecular formula | C20H28O5 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | 11,11-dimethyl-5-propan-2-yl-16-oxatetracyclo[6.6.2.01,10.02,7]hexadeca-2,4,6-triene-3,4,9,15-tetrol |
| InChIKey | BIRAIVMEZFVLJK-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=C2C(=C1)C3C(C4C2(CCCC4(C)C)C(O3)O)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
6-Epidemethylesquirolin D