CAS 1651-29-2 appears in our catalog under these names: 6-Chloro-2-fluoropurine, 6–Chloro–2–fluoropurine, 6-Chloro-2-fluoropurine, 97% , 6-Chloro-2-fluoropurine, 97%, 6-Chloro-2-fluoropurine, >97.0%(HPLC)(T). Offered by: TargetMol, GLPBio, Biosynth, Thermo Scientific (Alfa Aesar), Fluorochem. Available pack sizes: 1g, 250mg, 100g, 50g, 250g, 500mg, 5g, 10g.
6-chloro-2-fluoro-7H-purine (CAS 1651-29-2) is a chemical compound with the molecular formula C5H2ClFN4 and a molecular weight of 172.55 g/mol. IUPAC name: 6-chloro-2-fluoro-7H-purine. InChIKey: UNRIYCIDCQDGQE-UHFFFAOYSA-N.
| Molecular formula | C5H2ClFN4 |
|---|---|
| Molecular weight | 172.55 g/mol |
| IUPAC name | 6-chloro-2-fluoro-7H-purine |
| InChIKey | UNRIYCIDCQDGQE-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1)C(=NC(=N2)F)Cl |
Computed by PubChem (NCBI)