CAS 165115-78-6 is the registry number for Posaconazole Impurity 64. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-4-(2,4-difluorophenyl)-2-(phenylmethoxymethyl)pent-4-en-1-ol (CAS 165115-78-6) is a chemical compound with the molecular formula C19H20F2O2 and a molecular weight of 318.4 g/mol. IUPAC name: (2S)-4-(2,4-difluorophenyl)-2-(phenylmethoxymethyl)pent-4-en-1-ol. InChIKey: AOPZMJFZGCJBBM-INIZCTEOSA-N.
| Molecular formula | C19H20F2O2 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | (2S)-4-(2,4-difluorophenyl)-2-(phenylmethoxymethyl)pent-4-en-1-ol |
| InChIKey | AOPZMJFZGCJBBM-INIZCTEOSA-N |
| SMILES | C=C(C[C@@H](CO)COCC1=CC=CC=C1)C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)