CAS 165115-82-2 appears in our catalog under these names: Posaconazole Impurity 90, Posaconazole Impurity 65, Posaconazole Impurity 93. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(2R,4R)-2-(2,4-difluorophenyl)-2-(iodomethyl)-4-(phenylmethoxymethyl)oxolane (CAS 165115-82-2) is a chemical compound with the molecular formula C19H19F2IO2 and a molecular weight of 444.3 g/mol. IUPAC name: (2R,4R)-2-(2,4-difluorophenyl)-2-(iodomethyl)-4-(phenylmethoxymethyl)oxolane. InChIKey: MENSEIKEUWJAGJ-BEFAXECRSA-N.
| Molecular formula | C19H19F2IO2 |
|---|---|
| Molecular weight | 444.3 g/mol |
| IUPAC name | (2R,4R)-2-(2,4-difluorophenyl)-2-(iodomethyl)-4-(phenylmethoxymethyl)oxolane |
| InChIKey | MENSEIKEUWJAGJ-BEFAXECRSA-N |
| SMILES | C1[C@@H](CO[C@@]1(CI)C2=C(C=C(C=C2)F)F)COCC3=CC=CC=C3 |
Computed by PubChem (NCBI)