Products 1651179-19-9
CAS 1651179-19-9 is the registry number for SDI-118, 98.86%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 100 mg, 10mM/1mL, 50 mg, 25 mg.
(4R)-1-[(5-chloro-1,2,4-triazol-1-yl)methyl]-4-(3,4,5-trifluorophenyl)pyrrolidin-2-one (CAS 1651179-19-9) is a chemical compound with the molecular formula C13H10ClF3N4O and a molecular weight of 330.69 g/mol. IUPAC name: (4R)-1-[(5-chloro-1,2,4-triazol-1-yl)methyl]-4-(3,4,5-trifluorophenyl)pyrrolidin-2-one. InChIKey: GPGBFZCJDZALPN-QMMMGPOBSA-N.
| Molecular formula | C13H10ClF3N4O |
|---|---|
| Molecular weight | 330.69 g/mol |
| IUPAC name | (4R)-1-[(5-chloro-1,2,4-triazol-1-yl)methyl]-4-(3,4,5-trifluorophenyl)pyrrolidin-2-one |
| InChIKey | GPGBFZCJDZALPN-QMMMGPOBSA-N |
| SMILES | C1[C@@H](CN(C1=O)CN2C(=NC=N2)Cl)C3=CC(=C(C(=C3)F)F)F |
Computed by PubChem (NCBI)