CAS 1652-39-7 is the registry number for Flucytosine Impurity 1 . Offered by: Chemat Brand. Available pack sizes: on request.
Sodium (Z)-3-ethoxy-2-fluoro-3-oxoprop-1-en-1-olate (CAS 1652-39-7) is a chemical compound with the molecular formula C5H6FNaO3 and a molecular weight of 156.09 g/mol. IUPAC name: sodium (Z)-3-ethoxy-2-fluoro-3-oxoprop-1-en-1-olate. InChIKey: QWIHVUUEJBINLC-LNKPDPKZSA-M.
| Molecular formula | C5H6FNaO3 |
|---|---|
| Molecular weight | 156.09 g/mol |
| IUPAC name | sodium (Z)-3-ethoxy-2-fluoro-3-oxoprop-1-en-1-olate |
| InChIKey | QWIHVUUEJBINLC-LNKPDPKZSA-M |
| SMILES | CCOC(=O)/C(=C/[O-])/F.[Na+] |
Computed by PubChem (NCBI)