CAS 1652-60-4 appears in our catalog under these names: 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoroundecyl prop-2-enoate, 95%, 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoroundecyl acrylate, ≥98.0%, ≥98.0%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 250mg, 100g, 25g.
4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl prop-2-enoate (CAS 1652-60-4) is a chemical compound with the molecular formula C14H9F17O2 and a molecular weight of 532.19 g/mol. IUPAC name: 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl prop-2-enoate. InChIKey: GHAHNTDCKCXNGO-UHFFFAOYSA-N.
| Molecular formula | C14H9F17O2 |
|---|---|
| Molecular weight | 532.19 g/mol |
| IUPAC name | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl prop-2-enoate |
| InChIKey | GHAHNTDCKCXNGO-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCCCC(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)