CAS 16523-31-2 appears in our catalog under these names: 4,6–Diaminoresorcinol Dihydrochloride, 4,6-Diaminoresorcinol dihydrochloride, 4,6-Diaminoresorcinol Dihydrochloride, >98.0%(N)(T), 4,6-Diaminoresorcinol dihydrochloride, 98%, 4,6-Diaminobenzene-1,3-diol dihydrochloride 97%. Offered by: GLPBio, Biosynth, TCI, Thermo Scientific (Acros), Ambeed. Available pack sizes: 100g, 25g, 50g, 5g, 250g, 500g, 1000g, 250mg.
4,6-diaminobenzene-1,3-diol;dihydrochloride (CAS 16523-31-2) is a chemical compound with the molecular formula C6H10Cl2N2O2 and a molecular weight of 213.06 g/mol. IUPAC name: 4,6-diaminobenzene-1,3-diol;dihydrochloride. InChIKey: KUMOYHHELWKOCB-UHFFFAOYSA-N.
| Molecular formula | C6H10Cl2N2O2 |
|---|---|
| Molecular weight | 213.06 g/mol |
| IUPAC name | 4,6-diaminobenzene-1,3-diol;dihydrochloride |
| InChIKey | KUMOYHHELWKOCB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1N)O)O)N.Cl.Cl |
Computed by PubChem (NCBI)