CAS 1652582-08-5 appears in our catalog under these names: Pelubiprofen Impurity 8, rel-4-(((1R,2S)-2-Hydroxycyclohexyl)methyl) Pelubiprofen. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
2-[4-[[(1S,2R)-2-hydroxycyclohexyl]methyl]phenyl]propanoic acid (CAS 1652582-08-5) is a chemical compound with the molecular formula C16H22O3 and a molecular weight of 262.34 g/mol. IUPAC name: 2-[4-[[(1S,2R)-2-hydroxycyclohexyl]methyl]phenyl]propanoic acid. InChIKey: MCDKWYZDOMTURB-YUIIUQSRSA-N.
| Molecular formula | C16H22O3 |
|---|---|
| Molecular weight | 262.34 g/mol |
| IUPAC name | 2-[4-[[(1S,2R)-2-hydroxycyclohexyl]methyl]phenyl]propanoic acid |
| InChIKey | MCDKWYZDOMTURB-YUIIUQSRSA-N |
| SMILES | CC(C1=CC=C(C=C1)C[C@@H]2CCCC[C@H]2O)C(=O)O |
Computed by PubChem (NCBI)