Products 1652586-29-2

CAS 1652586-29-2 is the registry number for Tranexamic Acid Impurity 30. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-(bromomethyl)cyclohexane-1-carboxylic acid (CAS 1652586-29-2) is a chemical compound with the molecular formula C8H13BrO2 and a molecular weight of 221.09 g/mol. IUPAC name: 4-(bromomethyl)cyclohexane-1-carboxylic acid. InChIKey: UTIWRRUHZROKJN-UHFFFAOYSA-N.

Identity
Molecular formulaC8H13BrO2
Molecular weight221.09 g/mol
IUPAC name4-(bromomethyl)cyclohexane-1-carboxylic acid
InChIKeyUTIWRRUHZROKJN-UHFFFAOYSA-N
SMILESC1CC(CCC1CBr)C(=O)O

Computed by PubChem (NCBI)