CAS 16527-05-2 appears in our catalog under these names: Propane–2,2–diylbis(4,1–phenylene) bis(2–hydroxybenzoate), Propane-2,2-diylbis(4,1-phenylene) bis(2-hydroxybenzoate), 95%, Propane-2,2-diylbis(4,1-phenylene) bis(2-hydroxybenzoate), 95%, 95%. Offered by: GLPBio, Combi-blocks, Chemat. Available pack sizes: 100mg, 1g, 250mg.
[4-[2-[4-(2-hydroxybenzoyl)oxyphenyl]propan-2-yl]phenyl] 2-hydroxybenzoate (CAS 16527-05-2) is a chemical compound with the molecular formula C29H24O6 and a molecular weight of 468.5 g/mol. IUPAC name: [4-[2-[4-(2-hydroxybenzoyl)oxyphenyl]propan-2-yl]phenyl] 2-hydroxybenzoate. InChIKey: HEIPCDMHAQLHKV-UHFFFAOYSA-N.
| Molecular formula | C29H24O6 |
|---|---|
| Molecular weight | 468.5 g/mol |
| IUPAC name | [4-[2-[4-(2-hydroxybenzoyl)oxyphenyl]propan-2-yl]phenyl] 2-hydroxybenzoate |
| InChIKey | HEIPCDMHAQLHKV-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)OC(=O)C2=CC=CC=C2O)C3=CC=C(C=C3)OC(=O)C4=CC=CC=C4O |
Computed by PubChem (NCBI)