CAS 16527-35-8 appears in our catalog under these names: Sodium triphenylsilanolate, 97%, Sodium triphenylsilanolate, 95%, Sodium triphenylsilanolate 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 25g, 250mg.
Sodium oxido(triphenyl)silane (CAS 16527-35-8) is a chemical compound with the molecular formula C18H15NaOSi and a molecular weight of 298.4 g/mol. IUPAC name: sodium oxido(triphenyl)silane. InChIKey: RTXDMWNDEUYXPG-UHFFFAOYSA-N.
| Molecular formula | C18H15NaOSi |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | sodium oxido(triphenyl)silane |
| InChIKey | RTXDMWNDEUYXPG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[Si](C2=CC=CC=C2)(C3=CC=CC=C3)[O-].[Na+] |
Computed by PubChem (NCBI)