Products 165316-09-6
CAS 165316-09-6 is the registry number for Ritonavir Impurity 57. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-[[(2-ethyl-1,3-thiazol-4-yl)methyl-methylcarbamoyl]amino]-3-methylbutanoic acid (CAS 165316-09-6) is a chemical compound with the molecular formula C13H21N3O3S and a molecular weight of 299.39 g/mol. IUPAC name: (2S)-2-[[(2-ethyl-1,3-thiazol-4-yl)methyl-methylcarbamoyl]amino]-3-methylbutanoic acid. InChIKey: XPUHDKJOIISFES-NSHDSACASA-N.
| Molecular formula | C13H21N3O3S |
|---|---|
| Molecular weight | 299.39 g/mol |
| IUPAC name | (2S)-2-[[(2-ethyl-1,3-thiazol-4-yl)methyl-methylcarbamoyl]amino]-3-methylbutanoic acid |
| InChIKey | XPUHDKJOIISFES-NSHDSACASA-N |
| SMILES | CCC1=NC(=CS1)CN(C)C(=O)N[C@@H](C(C)C)C(=O)O |
Computed by PubChem (NCBI)