CAS 165325-62-2 appears in our catalog under these names: Tris(2-(perfluorohexyl)ethyl) phosphate, Tris(2-(perfluorohexyl)ethyl) Phosphate, >95% (HPLC), Tris(1H,1H,2H,2H-perfluorooctyl)phosphate. Offered by: Biosynth, TRC, Dr. Ehrenstorfer. Available pack sizes: 2mg, 1mg, 5mg, 10mg, 25mg, 100mg.
Tris(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) phosphate (CAS 165325-62-2) is a chemical compound with the molecular formula C24H12F39O4P and a molecular weight of 1136.3 g/mol. IUPAC name: tris(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) phosphate. InChIKey: LCACBPBFZQHXSG-UHFFFAOYSA-N.
| Molecular formula | C24H12F39O4P |
|---|---|
| Molecular weight | 1136.3 g/mol |
| IUPAC name | tris(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) phosphate |
| InChIKey | LCACBPBFZQHXSG-UHFFFAOYSA-N |
| SMILES | C(COP(=O)(OCCC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)OCCC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)