Products 16533-71-4
CAS 16533-71-4 appears in our catalog under these names: 4–Methyl–3,5–dinitrobenzoic Acid, 3,5-Dinitro-4-methylbenzoic acid, 4-Methyl-3,5-dinitrobenzoic acid 95%, 3,5-Dinitro-4-methylbenzoic acid, 95%, 4-Methyl-3,5-dinitrobenzoic acid, 95%, 95%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem, Chemat. Available pack sizes: 100g, 500g, 250g, 10g, 1000g, 25g, 5 g.
4-methyl-3,5-dinitrobenzoic acid (CAS 16533-71-4) is a chemical compound with the molecular formula C8H6N2O6 and a molecular weight of 226.14 g/mol. IUPAC name: 4-methyl-3,5-dinitrobenzoic acid. InChIKey: LZWWZQXBKVZKIP-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O6 |
|---|---|
| Molecular weight | 226.14 g/mol |
| IUPAC name | 4-methyl-3,5-dinitrobenzoic acid |
| InChIKey | LZWWZQXBKVZKIP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1[N+](=O)[O-])C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
4-Methyl-3,5-dinitrobenzoic acid, 3,5-Dinitro-p-toluic acid, p-Toluic acid, 3,5-dinitro-, 3,5Dinitro4toluic acid, 3,5Dinitro4methylbenzoic acid, Benzoic acid, 4methyl3,5dinitro, InChI=1/C8H6N2O6/c1-4-6(9(13)14)2-5(8(11)12)3-7(4)10(15)16/h2-3H,1H3,(H,11,12, LZWWZQXBKVZKIP-UHFFFAOYSA-N, 3,5-Dinitro-4-methylbenzoic acid, Benzoic acid, 4-methyl-3,5-dinitro-