CAS 165459-70-1 appears in our catalog under these names: 5-Isocyanobenzo(d)(1,3)dioxole, 95%, 5-Isocyano-1,3-dioxaindane. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-isocyano-1,3-benzodioxole (CAS 165459-70-1) is a chemical compound with the molecular formula C8H5NO2 and a molecular weight of 147.13 g/mol. IUPAC name: 5-isocyano-1,3-benzodioxole. InChIKey: WUKXVUFHYLHUEA-UHFFFAOYSA-N.
| Molecular formula | C8H5NO2 |
|---|---|
| Molecular weight | 147.13 g/mol |
| IUPAC name | 5-isocyano-1,3-benzodioxole |
| InChIKey | WUKXVUFHYLHUEA-UHFFFAOYSA-N |
| SMILES | [C-]#[N+]C1=CC2=C(C=C1)OCO2 |
Computed by PubChem (NCBI)