Products 1654735-36-0
CAS 1654735-36-0 is the registry number for PARP1-IN-6. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(E)-2-(3-fluorophenyl)ethenyl]-3H-quinazolin-4-one (CAS 1654735-36-0) is a chemical compound with the molecular formula C16H11FN2O and a molecular weight of 266.27 g/mol. IUPAC name: 2-[(E)-2-(3-fluorophenyl)ethenyl]-3H-quinazolin-4-one. InChIKey: ZFGIVIZXCYOWBK-CMDGGOBGSA-N.
| Molecular formula | C16H11FN2O |
|---|---|
| Molecular weight | 266.27 g/mol |
| IUPAC name | 2-[(E)-2-(3-fluorophenyl)ethenyl]-3H-quinazolin-4-one |
| InChIKey | ZFGIVIZXCYOWBK-CMDGGOBGSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NC(=N2)/C=C/C3=CC(=CC=C3)F |
Computed by PubChem (NCBI)