CAS 1654737-32-2 is the registry number for Valganciclovir Impurity 10. Offered by: Chemat Brand. Available pack sizes: on request.
[2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-3-chloropropyl] (2S)-2-amino-3-methylbutanoate;hydrochloride (CAS 1654737-32-2) is a chemical compound with the molecular formula C14H22Cl2N6O4 and a molecular weight of 409.3 g/mol. IUPAC name: [2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-3-chloropropyl] (2S)-2-amino-3-methylbutanoate;hydrochloride. InChIKey: BGUFTZRDDXNFAQ-MTFPJWTKSA-N.
| Molecular formula | C14H22Cl2N6O4 |
|---|---|
| Molecular weight | 409.3 g/mol |
| IUPAC name | [2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-3-chloropropyl] (2S)-2-amino-3-methylbutanoate;hydrochloride |
| InChIKey | BGUFTZRDDXNFAQ-MTFPJWTKSA-N |
| SMILES | CC(C)[C@@H](C(=O)OCC(CCl)OCN1C=NC2=C1N=C(NC2=O)N)N.Cl |
Computed by PubChem (NCBI)