Products 1654755-06-2

CAS 1654755-06-2 is the registry number for 2-Chloro-5-fluoro-nicotinic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Tert-butyl 2-chloro-5-fluoropyridine-3-carboxylate (CAS 1654755-06-2) is a chemical compound with the molecular formula C10H11ClFNO2 and a molecular weight of 231.65 g/mol. IUPAC name: tert-butyl 2-chloro-5-fluoropyridine-3-carboxylate. InChIKey: MVMJNOFOZIFNRK-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11ClFNO2
Molecular weight231.65 g/mol
IUPAC nametert-butyl 2-chloro-5-fluoropyridine-3-carboxylate
InChIKeyMVMJNOFOZIFNRK-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)C1=C(N=CC(=C1)F)Cl

Computed by PubChem (NCBI)