CAS 165523-04-6 is the registry number for trans-(±)-3,5-Dihydroxy-cyclohexanone. Offered by: TRC. Available pack sizes: 1g.
Trans-(3R,5R)-3,5-dihydroxycyclohexan-1-one (CAS 165523-04-6) is a chemical compound with the molecular formula C6H10O3 and a molecular weight of 130.14 g/mol. IUPAC name: trans-(3R,5R)-3,5-dihydroxycyclohexan-1-one. InChIKey: WTRJYFFVLSDQFC-RFZPGFLSSA-N.
| Molecular formula | C6H10O3 |
|---|---|
| Molecular weight | 130.14 g/mol |
| IUPAC name | trans-(3R,5R)-3,5-dihydroxycyclohexan-1-one |
| InChIKey | WTRJYFFVLSDQFC-RFZPGFLSSA-N |
| SMILES | C1[C@H](CC(=O)C[C@@H]1O)O |
Computed by PubChem (NCBI)