CAS 165534-43-0 appears in our catalog under these names: DEPBT, 3-Diethoxyphosphoryloxy-1,2,3-benzotriazin-4(3H)-one, 98% , 3-(Diethoxyphosphoryloxy)-1,2,3-benzotriazin-4(3H)-one, >98.0%(HPLC)(N), DEPBT 98%, Diethyl (4-oxobenzo[d][1,2,3]triazin-3(4H)-yl) phosphate, 98%, 98%. Offered by: GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 100g, 25g, 5g, 10g, 50g, 500g, 1000g, 1kg.
Diethyl (4-oxo-1,2,3-benzotriazin-3-yl) phosphate (CAS 165534-43-0) is a chemical compound with the molecular formula C11H14N3O5P and a molecular weight of 299.22 g/mol. IUPAC name: diethyl (4-oxo-1,2,3-benzotriazin-3-yl) phosphate. InChIKey: AJDPNPAGZMZOMN-UHFFFAOYSA-N.
| Molecular formula | C11H14N3O5P |
|---|---|
| Molecular weight | 299.22 g/mol |
| IUPAC name | diethyl (4-oxo-1,2,3-benzotriazin-3-yl) phosphate |
| InChIKey | AJDPNPAGZMZOMN-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)ON1C(=O)C2=CC=CC=C2N=N1 |
Computed by PubChem (NCBI)