CAS 165537-72-4 is the registry number for TP receptor antagonist-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
CAS 165537-72-4 identifies a chemical compound with the molecular formula C19H20ClNNaO4S and a molecular weight of 416.9 g/mol. InChIKey: NTIMKJPXPOYGQZ-UHFFFAOYSA-N.
| Molecular formula | C19H20ClNNaO4S |
|---|---|
| Molecular weight | 416.9 g/mol |
| InChIKey | NTIMKJPXPOYGQZ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(CC1NS(=O)(=O)C3=CC=C(C=C3)Cl)C=CC=C2CCC(=O)O.[Na] |
Computed by PubChem (NCBI)