CAS 16562-77-9 appears in our catalog under these names: Sodium 2-oxopropane-1-sulfonate, 98%, Sodium Acetonesulfonate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
Sodium 2-oxopropane-1-sulfonate (CAS 16562-77-9) is a chemical compound with the molecular formula C3H5NaO4S and a molecular weight of 160.13 g/mol. IUPAC name: sodium 2-oxopropane-1-sulfonate. InChIKey: VJKBASZAUBWVDG-UHFFFAOYSA-M.
| Molecular formula | C3H5NaO4S |
|---|---|
| Molecular weight | 160.13 g/mol |
| IUPAC name | sodium 2-oxopropane-1-sulfonate |
| InChIKey | VJKBASZAUBWVDG-UHFFFAOYSA-M |
| SMILES | CC(=O)CS(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)