Products 165740-03-4
CAS 165740-03-4 appears in our catalog under these names: Loratadine Impurity 36, Methyl Analogue of Loratadine, Desloratadine N-Carboxylic Acid Methyl Ester, >95% (HPLC), Desloratadine N-carboxylic acid methyl ester. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 1g, 25mg, 10mg, 50mg.
Methyl 4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate (CAS 165740-03-4) is a chemical compound with the molecular formula C21H21ClN2O2 and a molecular weight of 368.9 g/mol. IUPAC name: methyl 4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate. InChIKey: XTGUGVYFFYZHSJ-UHFFFAOYSA-N.
| Molecular formula | C21H21ClN2O2 |
|---|---|
| Molecular weight | 368.9 g/mol |
| IUPAC name | methyl 4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate |
| InChIKey | XTGUGVYFFYZHSJ-UHFFFAOYSA-N |
| SMILES | COC(=O)N1CCC(=C2C3=C(CCC4=C2N=CC=C4)C=C(C=C3)Cl)CC1 |
Computed by PubChem (NCBI)