CAS 165749-18-8 is the registry number for 3,4-Bis(((1,1-dimethylethyl)dimethylsilyl)oxy)benzeneethanamine. Offered by: TRC. Available pack sizes: 250mg.
2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]ethanamine (CAS 165749-18-8) is a chemical compound with the molecular formula C20H39NO2Si2 and a molecular weight of 381.7 g/mol. IUPAC name: 2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]ethanamine. InChIKey: BGHCEVNROQMEGV-UHFFFAOYSA-N.
| Molecular formula | C20H39NO2Si2 |
|---|---|
| Molecular weight | 381.7 g/mol |
| IUPAC name | 2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]ethanamine |
| InChIKey | BGHCEVNROQMEGV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1=C(C=C(C=C1)CCN)O[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)