Products 165806-50-8
CAS 165806-50-8 is the registry number for p38 MAPK-IN-7. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[5-(4-fluorophenyl)-3-propan-2-ylimidazol-4-yl]pyrimidin-2-amine (CAS 165806-50-8) is a chemical compound with the molecular formula C16H16FN5 and a molecular weight of 297.33 g/mol. IUPAC name: 4-[5-(4-fluorophenyl)-3-propan-2-ylimidazol-4-yl]pyrimidin-2-amine. InChIKey: XVCSWAQWAKYULT-UHFFFAOYSA-N.
| Molecular formula | C16H16FN5 |
|---|---|
| Molecular weight | 297.33 g/mol |
| IUPAC name | 4-[5-(4-fluorophenyl)-3-propan-2-ylimidazol-4-yl]pyrimidin-2-amine |
| InChIKey | XVCSWAQWAKYULT-UHFFFAOYSA-N |
| SMILES | CC(C)N1C=NC(=C1C2=NC(=NC=C2)N)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)