CAS 16583-02-1 is the registry number for 2–Bromo–3,4,5,6–tetrafluorobenzonitrile. Offered by: GLPBio. Available pack sizes: 100mg, 50mg.
2-bromo-3,4,5,6-tetrafluorobenzonitrile (CAS 16583-02-1) is a chemical compound with the molecular formula C7BrF4N and a molecular weight of 253.98 g/mol. IUPAC name: 2-bromo-3,4,5,6-tetrafluorobenzonitrile. InChIKey: USIQSEVWPHCOSR-UHFFFAOYSA-N.
| Molecular formula | C7BrF4N |
|---|---|
| Molecular weight | 253.98 g/mol |
| IUPAC name | 2-bromo-3,4,5,6-tetrafluorobenzonitrile |
| InChIKey | USIQSEVWPHCOSR-UHFFFAOYSA-N |
| SMILES | C(#N)C1=C(C(=C(C(=C1Br)F)F)F)F |
Computed by PubChem (NCBI)