CAS 16583-04-3 is the registry number for 2-Bromo-3,4,5,6-tetrafluorobenzoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-3,4,5,6-tetrafluorobenzoic acid (CAS 16583-04-3) is a chemical compound with the molecular formula C7HBrF4O2 and a molecular weight of 272.98 g/mol. IUPAC name: 2-bromo-3,4,5,6-tetrafluorobenzoic acid. InChIKey: CSQFCJLDFYDOGY-UHFFFAOYSA-N.
| Molecular formula | C7HBrF4O2 |
|---|---|
| Molecular weight | 272.98 g/mol |
| IUPAC name | 2-bromo-3,4,5,6-tetrafluorobenzoic acid |
| InChIKey | CSQFCJLDFYDOGY-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1Br)F)F)F)F)C(=O)O |
Computed by PubChem (NCBI)