Products 16583-04-3

CAS 16583-04-3 is the registry number for 2-Bromo-3,4,5,6-tetrafluorobenzoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

2-bromo-3,4,5,6-tetrafluorobenzoic acid (CAS 16583-04-3) is a chemical compound with the molecular formula C7HBrF4O2 and a molecular weight of 272.98 g/mol. IUPAC name: 2-bromo-3,4,5,6-tetrafluorobenzoic acid. InChIKey: CSQFCJLDFYDOGY-UHFFFAOYSA-N.

Identity
Molecular formulaC7HBrF4O2
Molecular weight272.98 g/mol
IUPAC name2-bromo-3,4,5,6-tetrafluorobenzoic acid
InChIKeyCSQFCJLDFYDOGY-UHFFFAOYSA-N
SMILESC1(=C(C(=C(C(=C1Br)F)F)F)F)C(=O)O

Computed by PubChem (NCBI)