CAS 16587-52-3 is the registry number for 3-Methyldibenzothiophene. Offered by: TRC. Available pack sizes: 100mg.
3-methyldibenzothiophene (CAS 16587-52-3) is a chemical compound with the molecular formula C13H10S and a molecular weight of 198.29 g/mol. IUPAC name: 3-methyldibenzothiophene. InChIKey: URUCEYZTJIJMLX-UHFFFAOYSA-N.
| Molecular formula | C13H10S |
|---|---|
| Molecular weight | 198.29 g/mol |
| IUPAC name | 3-methyldibenzothiophene |
| InChIKey | URUCEYZTJIJMLX-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C3=CC=CC=C3S2 |
Computed by PubChem (NCBI)