CAS 16589-24-5 appears in our catalog under these names: Synephrine tartrate, 98%, Synephrine Tartrate, Synephrine Tartrate, >98.0%(HPLC)(T), (+/-)-Synephrine tartrate, Synephrine hemitartrate, 98.0%, 98.0%. Offered by: Combi-blocks, GLPBio, TCI, Biosynth, Chemat. Available pack sizes: 25g, 100g, 1g, 5g, 50g, 250g, 5mg, 25mg.
(2R,3R)-2,3-dihydroxybutanedioic acid;bis(4-[1-hydroxy-2-(methylamino)ethyl]phenol) (CAS 16589-24-5) is a chemical compound with the molecular formula C22H32N2O10 and a molecular weight of 484.5 g/mol. IUPAC name: (2R,3R)-2,3-dihydroxybutanedioic acid;bis(4-[1-hydroxy-2-(methylamino)ethyl]phenol). InChIKey: KZZBAIXGUQOHKI-CEAXSRTFSA-N.
| Molecular formula | C22H32N2O10 |
|---|---|
| Molecular weight | 484.5 g/mol |
| IUPAC name | (2R,3R)-2,3-dihydroxybutanedioic acid;bis(4-[1-hydroxy-2-(methylamino)ethyl]phenol) |
| InChIKey | KZZBAIXGUQOHKI-CEAXSRTFSA-N |
| SMILES | CNCC(C1=CC=C(C=C1)O)O.CNCC(C1=CC=C(C=C1)O)O.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)