CAS 165904-20-1 is the registry number for 2-Trimethylsilyl-1-ethylboronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Trimethyl-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]silane (CAS 165904-20-1) is a chemical compound with the molecular formula C11H25BO2Si and a molecular weight of 228.21 g/mol. IUPAC name: trimethyl-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]silane. InChIKey: YKYAZAJUMAWTGO-UHFFFAOYSA-N.
| Molecular formula | C11H25BO2Si |
|---|---|
| Molecular weight | 228.21 g/mol |
| IUPAC name | trimethyl-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]silane |
| InChIKey | YKYAZAJUMAWTGO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC[Si](C)(C)C |
Computed by PubChem (NCBI)