CAS 16591-56-3 appears in our catalog under these names: (SP-4-1)-[5,10,15,20-Tetraphenyl-21H,23H-porphinato(2-)-κN21,κN22,κN23,κN24]iron, 98%, 98%, Tetraphenylporphineiron(II), 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Iron(2+);5,10,15,20-tetraphenylporphyrin-22,24-diide (CAS 16591-56-3) is a chemical compound with the molecular formula C44H28FeN4 and a molecular weight of 668.6 g/mol. IUPAC name: iron(2+);5,10,15,20-tetraphenylporphyrin-22,24-diide. InChIKey: ZWYCMWUUWAFXIA-UHFFFAOYSA-N.
| Molecular formula | C44H28FeN4 |
|---|---|
| Molecular weight | 668.6 g/mol |
| IUPAC name | iron(2+);5,10,15,20-tetraphenylporphyrin-22,24-diide |
| InChIKey | ZWYCMWUUWAFXIA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C3C=CC(=C(C4=NC(=C(C5=CC=C([N-]5)C(=C6C=CC2=N6)C7=CC=CC=C7)C8=CC=CC=C8)C=C4)C9=CC=CC=C9)[N-]3.[Fe+2] |
Computed by PubChem (NCBI)