CAS 1659311-47-3 appears in our catalog under these names: Sarpogrelate Impurity 3, Sarpogrelate Related Compound III HCl, Sarpogrelate related compound III hydrochloride, Sarpogrelate Impurity 4. Offered by: Chemat Brand, Biosynth, Hubei YoungXin. Available pack sizes: on request, 200mg, 100mg, 10mg, 25mg, 50mg.
4-[1-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]-3-(methylamino)propan-2-yl]oxy-4-oxobutanoic acid (CAS 1659311-47-3) is a chemical compound with the molecular formula C23H29NO6 and a molecular weight of 415.5 g/mol. IUPAC name: 4-[1-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]-3-(methylamino)propan-2-yl]oxy-4-oxobutanoic acid. InChIKey: PWFWNIUOZDMDPQ-UHFFFAOYSA-N.
| Molecular formula | C23H29NO6 |
|---|---|
| Molecular weight | 415.5 g/mol |
| IUPAC name | 4-[1-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]-3-(methylamino)propan-2-yl]oxy-4-oxobutanoic acid |
| InChIKey | PWFWNIUOZDMDPQ-UHFFFAOYSA-N |
| SMILES | CNCC(COC1=CC=CC=C1CCC2=CC(=CC=C2)OC)OC(=O)CCC(=O)O |
Computed by PubChem (NCBI)