CAS 165963-57-5 appears in our catalog under these names: 5-Hydroxy-2-methyl-2-adamantanol, 4-Methyladamantane-1,4-diol, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 250mg, 500mg, 1000mg, 100mg, 1g.
4-methyladamantane-1,4-diol (CAS 165963-57-5) is a chemical compound with the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. IUPAC name: 4-methyladamantane-1,4-diol. InChIKey: ALZUAKQPIUGQKR-UHFFFAOYSA-N.
| Molecular formula | C11H18O2 |
|---|---|
| Molecular weight | 182.26 g/mol |
| IUPAC name | 4-methyladamantane-1,4-diol |
| InChIKey | ALZUAKQPIUGQKR-UHFFFAOYSA-N |
| SMILES | CC1(C2CC3CC1CC(C3)(C2)O)O |
Computed by PubChem (NCBI)