CAS 165963-71-3 appears in our catalog under these names: 2-(2-(2-t-Boc-aminoethoxy)ethoxy)ethyl Bromide, N–Boc–PEG3–bromide, N-Boc-PEG2-bromide 97%, tert-Butyl (2-(2-(2-bromoethoxy)ethoxy)ethyl)carbamate, 97%, 97%, N-Boc-PEG2-bromide, 98.19%. Offered by: TRC, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 25g, 100g, 10g.
Tert-butyl N-[2-[2-(2-bromoethoxy)ethoxy]ethyl]carbamate (CAS 165963-71-3) is a chemical compound with the molecular formula C11H22BrNO4 and a molecular weight of 312.20 g/mol. IUPAC name: tert-butyl N-[2-[2-(2-bromoethoxy)ethoxy]ethyl]carbamate. InChIKey: WGWDCMKAMHBDPO-UHFFFAOYSA-N.
| Molecular formula | C11H22BrNO4 |
|---|---|
| Molecular weight | 312.20 g/mol |
| IUPAC name | tert-butyl N-[2-[2-(2-bromoethoxy)ethoxy]ethyl]carbamate |
| InChIKey | WGWDCMKAMHBDPO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCBr |
Computed by PubChem (NCBI)