CAS 16609-64-6 is the registry number for (1R,3R,5S)–6,6–Dimethylbicyclo(3·1·0)hexan–3–ol. Offered by: GLPBio. Available pack sizes: 100mg, 25mg.
(1R,5S)-6,6-dimethylbicyclo[3.1.0]hexan-3-ol (CAS 16609-64-6) is a chemical compound with the molecular formula C8H14O and a molecular weight of 126.20 g/mol. IUPAC name: (1R,5S)-6,6-dimethylbicyclo[3.1.0]hexan-3-ol. InChIKey: HUADUHNYPJBEBQ-DGUCWDHESA-N.
| Molecular formula | C8H14O |
|---|---|
| Molecular weight | 126.20 g/mol |
| IUPAC name | (1R,5S)-6,6-dimethylbicyclo[3.1.0]hexan-3-ol |
| InChIKey | HUADUHNYPJBEBQ-DGUCWDHESA-N |
| SMILES | CC1([C@H]2[C@@H]1CC(C2)O)C |
Computed by PubChem (NCBI)