CAS 16616-42-5 is the registry number for 1-(4-Chlorophenyl)-3-phenyl-2-propyn-1-one, 98.0%, 98.0%. Offered by: Chemat. Available pack sizes: 250mg.
1-(4-chlorophenyl)-3-phenylprop-2-yn-1-one (CAS 16616-42-5) is a chemical compound with the molecular formula C15H9ClO and a molecular weight of 240.68 g/mol. IUPAC name: 1-(4-chlorophenyl)-3-phenylprop-2-yn-1-one. InChIKey: ORAGQXBNCMMOIW-UHFFFAOYSA-N.
| Molecular formula | C15H9ClO |
|---|---|
| Molecular weight | 240.68 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-3-phenylprop-2-yn-1-one |
| InChIKey | ORAGQXBNCMMOIW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C#CC(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)