CAS 166187-02-6 is the registry number for (2R,4S)-4-Hydroxypyrrolidine-2-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,4S)-4-hydroxypyrrolidine-2-carboxamide (CAS 166187-02-6) is a chemical compound with the molecular formula C5H10N2O2 and a molecular weight of 130.15 g/mol. IUPAC name: (2R,4S)-4-hydroxypyrrolidine-2-carboxamide. InChIKey: OJSXAYGYRGXDSQ-IUYQGCFVSA-N.
| Molecular formula | C5H10N2O2 |
|---|---|
| Molecular weight | 130.15 g/mol |
| IUPAC name | (2R,4S)-4-hydroxypyrrolidine-2-carboxamide |
| InChIKey | OJSXAYGYRGXDSQ-IUYQGCFVSA-N |
| SMILES | C1[C@@H](CN[C@H]1C(=O)N)O |
Computed by PubChem (NCBI)