CAS 166322-31-2 appears in our catalog under these names: 6-Iodo-1,1,4,4-tetramethyl-1,2,3,4-tetrahydronaphthalene, 95%, 6–iodo–1,1,4,4–tetramethyl–1,2,3,4–tetrahydronaphthalene. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
6-iodo-1,1,4,4-tetramethyl-2,3-dihydronaphthalene (CAS 166322-31-2) is a chemical compound with the molecular formula C14H19I and a molecular weight of 314.20 g/mol. IUPAC name: 6-iodo-1,1,4,4-tetramethyl-2,3-dihydronaphthalene. InChIKey: ZCDMIFHZKQEGHB-UHFFFAOYSA-N.
| Molecular formula | C14H19I |
|---|---|
| Molecular weight | 314.20 g/mol |
| IUPAC name | 6-iodo-1,1,4,4-tetramethyl-2,3-dihydronaphthalene |
| InChIKey | ZCDMIFHZKQEGHB-UHFFFAOYSA-N |
| SMILES | CC1(CCC(C2=C1C=CC(=C2)I)(C)C)C |
Computed by PubChem (NCBI)