CAS 1663470-21-0 appears in our catalog under these names: 1,5-Naphthyridine-3,7-diboronic acid pinacol ester, 97%, 3,7-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-naphthyridine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
3,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-naphthyridine (CAS 1663470-21-0) is a chemical compound with the molecular formula C20H28B2N2O4 and a molecular weight of 382.1 g/mol. IUPAC name: 3,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-naphthyridine. InChIKey: MEBYQDZDPPSAEZ-UHFFFAOYSA-N.
| Molecular formula | C20H28B2N2O4 |
|---|---|
| Molecular weight | 382.1 g/mol |
| IUPAC name | 3,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-naphthyridine |
| InChIKey | MEBYQDZDPPSAEZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C(C=N3)B4OC(C(O4)(C)C)(C)C)N=C2 |
Computed by PubChem (NCBI)