CAS 166374-48-7 is the registry number for (6R)-Naxifylline. Offered by: MedChemExpress. Available pack sizes: Get quote.
8-[(1S,2R,4S,5S,6R)-3-oxatricyclo[3.2.1.02,4]octan-6-yl]-1,3-dipropyl-7H-purine-2,6-dione (CAS 166374-48-7) is a chemical compound with the molecular formula C18H24N4O3 and a molecular weight of 344.4 g/mol. IUPAC name: 8-[(1S,2R,4S,5S,6R)-3-oxatricyclo[3.2.1.02,4]octan-6-yl]-1,3-dipropyl-7H-purine-2,6-dione. InChIKey: OQCJPFYWFGUHIN-VGYDOTAVSA-N.
| Molecular formula | C18H24N4O3 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | 8-[(1S,2R,4S,5S,6R)-3-oxatricyclo[3.2.1.02,4]octan-6-yl]-1,3-dipropyl-7H-purine-2,6-dione |
| InChIKey | OQCJPFYWFGUHIN-VGYDOTAVSA-N |
| SMILES | CCCN1C2=C(C(=O)N(C1=O)CCC)NC(=N2)[C@@H]3C[C@H]4C[C@@H]3[C@H]5[C@@H]4O5 |
Computed by PubChem (NCBI)