CAS 166392-11-6 is the registry number for 2-Heptafluoropropylsulfanyl-phenylamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)aniline (CAS 166392-11-6) is a chemical compound with the molecular formula C9H6F7NS and a molecular weight of 293.21 g/mol. IUPAC name: 2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)aniline. InChIKey: XDXZADDGIVDJFS-UHFFFAOYSA-N.
| Molecular formula | C9H6F7NS |
|---|---|
| Molecular weight | 293.21 g/mol |
| IUPAC name | 2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)aniline |
| InChIKey | XDXZADDGIVDJFS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)SC(C(C(F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)