CAS 166402-54-6 is the registry number for 2-{(2-nitro-4-(trifluoromethyl)phenyl)amino}propanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-[2-nitro-4-(trifluoromethyl)anilino]propanoic acid (CAS 166402-54-6) is a chemical compound with the molecular formula C10H9F3N2O4 and a molecular weight of 278.18 g/mol. IUPAC name: 2-[2-nitro-4-(trifluoromethyl)anilino]propanoic acid. InChIKey: NSZTZQLWLHTSMN-UHFFFAOYSA-N.
| Molecular formula | C10H9F3N2O4 |
|---|---|
| Molecular weight | 278.18 g/mol |
| IUPAC name | 2-[2-nitro-4-(trifluoromethyl)anilino]propanoic acid |
| InChIKey | NSZTZQLWLHTSMN-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)NC1=C(C=C(C=C1)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)