Products 166402-54-6

CAS 166402-54-6 is the registry number for 2-{(2-nitro-4-(trifluoromethyl)phenyl)amino}propanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

2-[2-nitro-4-(trifluoromethyl)anilino]propanoic acid (CAS 166402-54-6) is a chemical compound with the molecular formula C10H9F3N2O4 and a molecular weight of 278.18 g/mol. IUPAC name: 2-[2-nitro-4-(trifluoromethyl)anilino]propanoic acid. InChIKey: NSZTZQLWLHTSMN-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9F3N2O4
Molecular weight278.18 g/mol
IUPAC name2-[2-nitro-4-(trifluoromethyl)anilino]propanoic acid
InChIKeyNSZTZQLWLHTSMN-UHFFFAOYSA-N
SMILESCC(C(=O)O)NC1=C(C=C(C=C1)C(F)(F)F)[N+](=O)[O-]

Computed by PubChem (NCBI)