Products 1664336-44-0
CAS 1664336-44-0 is the registry number for LPA5 antagonist 3. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[[2,2-difluoropropyl-[4-(2-fluorophenoxy)benzoyl]amino]methyl]benzoic acid (CAS 1664336-44-0) is a chemical compound with the molecular formula C24H20F3NO4 and a molecular weight of 443.4 g/mol. IUPAC name: 4-[[2,2-difluoropropyl-[4-(2-fluorophenoxy)benzoyl]amino]methyl]benzoic acid. InChIKey: ADACZCWUHYGVAD-UHFFFAOYSA-N.
| Molecular formula | C24H20F3NO4 |
|---|---|
| Molecular weight | 443.4 g/mol |
| IUPAC name | 4-[[2,2-difluoropropyl-[4-(2-fluorophenoxy)benzoyl]amino]methyl]benzoic acid |
| InChIKey | ADACZCWUHYGVAD-UHFFFAOYSA-N |
| SMILES | CC(CN(CC1=CC=C(C=C1)C(=O)O)C(=O)C2=CC=C(C=C2)OC3=CC=CC=C3F)(F)F |
Computed by PubChem (NCBI)