CAS 1664336-46-2 is the registry number for LPAR1 antagonist 2. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[[[4-(2-chlorophenoxy)benzoyl]-ethylamino]methyl]benzoic acid (CAS 1664336-46-2) is a chemical compound with the molecular formula C23H20ClNO4 and a molecular weight of 409.9 g/mol. IUPAC name: 4-[[[4-(2-chlorophenoxy)benzoyl]-ethylamino]methyl]benzoic acid. InChIKey: BIVGLZVHXLZIGP-UHFFFAOYSA-N.
| Molecular formula | C23H20ClNO4 |
|---|---|
| Molecular weight | 409.9 g/mol |
| IUPAC name | 4-[[[4-(2-chlorophenoxy)benzoyl]-ethylamino]methyl]benzoic acid |
| InChIKey | BIVGLZVHXLZIGP-UHFFFAOYSA-N |
| SMILES | CCN(CC1=CC=C(C=C1)C(=O)O)C(=O)C2=CC=C(C=C2)OC3=CC=CC=C3Cl |
Computed by PubChem (NCBI)