CAS 1664366-95-3 is the registry number for Di-tert-butyl 9-oxo-3,7-diaza-bicyclo[3.3.1]nonane-3,7-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Ditert-butyl 9-oxo-3,7-diazabicyclo[3.3.1]nonane-3,7-dicarboxylate (CAS 1664366-95-3) is a chemical compound with the molecular formula C17H28N2O5 and a molecular weight of 340.4 g/mol. IUPAC name: ditert-butyl 9-oxo-3,7-diazabicyclo[3.3.1]nonane-3,7-dicarboxylate. InChIKey: VCPBBNRLGBLHMF-UHFFFAOYSA-N.
| Molecular formula | C17H28N2O5 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | ditert-butyl 9-oxo-3,7-diazabicyclo[3.3.1]nonane-3,7-dicarboxylate |
| InChIKey | VCPBBNRLGBLHMF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2CN(CC(C1)C2=O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)